ChemNet > CAS > 337508-62-0 2,1,3-benzothiadiazol-5-yl isothiocyanate
337508-62-0 2,1,3-benzothiadiazol-5-yl isothiocyanate
| Название продукта |
2,1,3-benzothiadiazol-5-yl isothiocyanate |
| Синонимы |
5-isothiocyanato-2,1,3-benzothiadiazole |
| Молекулярная формула |
C7H3N3S2 |
| Молекулярный вес |
193.2488 |
| InChI |
InChI=1/C7H3N3S2/c11-4-8-5-1-2-6-7(3-5)10-12-9-6/h1-3H |
| Регистрационный номер CAS |
337508-62-0 |
| Молекулярная структура |
|
| Плотность |
1.54g/cm3 |
| Температура плавления |
93℃ |
| Точка кипения |
332.6°C at 760 mmHg |
| Показатель преломления |
1.807 |
| Температура вспышки |
155°C |
| Символы опасности |
 Xn:Harmful;
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
